C9H9NO2 — CID 12707221
1-pyridin-2-ylbutane-1,3-dione (PubChem CID 12707221) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-pyridin-2-ylbutane-1,3-dione.
| Compound Name | 1-pyridin-2-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 12707221 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1-pyridin-2-ylbutane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1ccccn1 |
| InChI | InChI=1S/C9H9NO2/c1-7(11)6-9(12)8-4-2-3-5-10-8/h2-5H,6H2,1H3 |
| InChIKey | ZKPDXFCMHFRNQC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|