About butane;ethane;1-pyridin-2-ylpropan-1-one
butane;ethane;1-pyridin-2-ylpropan-1-one (PubChem CID 144892300) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is butane;ethane;1-pyridin-2-ylpropan-1-one.
Molecular Properties
| Compound Name | butane;ethane;1-pyridin-2-ylpropan-1-one |
| PubChem CID | 144892300 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | butane;ethane;1-pyridin-2-ylpropan-1-one |
| SMILES | CC.CCC(=O)c1ccccn1.CCCC |
| InChI | InChI=1S/C8H9NO.C4H10.C2H6/c1-2-8(10)7-5-3-4-6-9-7;1-3-4-2;1-2/h3-6H,2H2,1H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | SRDDSDBRGZEGPI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;ethane;1-pyridin-2-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;1-pyridin-2-ylpropan-1-one?
The IUPAC name of butane;ethane;1-pyridin-2-ylpropan-1-one (CID 144892300) is butane;ethane;1-pyridin-2-ylpropan-1-one.
What is the SMILES notation for butane;ethane;1-pyridin-2-ylpropan-1-one?
The canonical SMILES for butane;ethane;1-pyridin-2-ylpropan-1-one is CC.CCC(=O)c1ccccn1.CCCC.
What is the InChIKey of butane;ethane;1-pyridin-2-ylpropan-1-one?
The InChIKey is SRDDSDBRGZEGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C4H10.C2H6/c1-2-8(10)7-5-3-4-6-9-7;1-3-4-2;1-2/h3-6H,2H2,1H3;3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;1-pyridin-2-ylpropan-1-one?
butane;ethane;1-pyridin-2-ylpropan-1-one has a molecular weight of 223.36 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;1-pyridin-2-ylpropan-1-one is sourced from PubChem (CID 144892300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).