C15H14N2O — CID 91328700
1,3-dipyridin-2-ylpent-2-en-1-one (PubChem CID 91328700) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 1,3-dipyridin-2-ylpent-2-en-1-one.
| Compound Name | 1,3-dipyridin-2-ylpent-2-en-1-one |
|---|---|
| PubChem CID | 91328700 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1,3-dipyridin-2-ylpent-2-en-1-one |
| SMILES | CCC(=CC(=O)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C15H14N2O/c1-2-12(13-7-3-5-9-16-13)11-15(18)14-8-4-6-10-17-14/h3-11H,2H2,1H3 |
| InChIKey | LOICTCUMPFWBGG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|