C11H13NO2 — CID 63319425
4-methyl-1-pyridin-2-ylpentane-1,3-dione (PubChem CID 63319425) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-methyl-1-pyridin-2-ylpentane-1,3-dione.
| Compound Name | 4-methyl-1-pyridin-2-ylpentane-1,3-dione |
|---|---|
| PubChem CID | 63319425 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-methyl-1-pyridin-2-ylpentane-1,3-dione |
| SMILES | CC(C)C(=O)CC(=O)c1ccccn1 |
| InChI | InChI=1S/C11H13NO2/c1-8(2)10(13)7-11(14)9-5-3-4-6-12-9/h3-6,8H,7H2,1-2H3 |
| InChIKey | RHFDZIHSWIEIIE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|