C12H11N5O2 — CID 135827974
1,7-dihydropurin-6-one;1-pyridin-2-ylethanone (PubChem CID 135827974) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1,7-dihydropurin-6-one;1-pyridin-2-ylethanone.
| Compound Name | 1,7-dihydropurin-6-one;1-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 135827974 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1,7-dihydropurin-6-one;1-pyridin-2-ylethanone |
| SMILES | CC(=O)c1ccccn1.O=c1[nH]cnc2nc[nH]c12 |
| InChI | InChI=1S/C7H7NO.C5H4N4O/c1-6(9)7-4-2-3-5-8-7;10-5-3-4(7-1-6-3)8-2-9-5/h2-5H,1H3;1-2H,(H2,6,7,8,9,10) |
| InChIKey | YBOCYLBBGQBTAQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |