C5H4N4O — CID 135546991
1,7-dihydropurin-6-one (PubChem CID 135546991) has the molecular formula C5H4N4O and a molecular weight of 138.10 g/mol. Its IUPAC name is 1,7-dihydropurin-6-one.
| Compound Name | 1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135546991 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 138.10 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 1,7-dihydropurin-6-one |
| SMILES | O=c1[15nH]c[15n]c2nc[nH]c12 |
| InChI | InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10)/i8+1,9+1 |
| InChIKey | FDGQSTZJBFJUBT-IOOOXAEESA-N |
| XLogP | -0.35 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.10 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |