C5H3ClN4O — CID 135421792
2-chloro-1,7-dihydropurin-6-one (PubChem CID 135421792) has the molecular formula C5H3ClN4O and a molecular weight of 170.56 g/mol. Its IUPAC name is 2-chloro-1,7-dihydropurin-6-one.
| Compound Name | 2-chloro-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135421792 |
| Molecular Formula | C5H3ClN4O |
| Molecular Weight | 170.56 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 2-chloro-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C5H3ClN4O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H2,7,8,9,10,11) |
| InChIKey | WIEATFFSFYPBQD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.56 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |