C5H5Cl2MgN5O — CID 174866452
magnesium;2-amino-1,7-dihydropurin-6-one;dichloride (PubChem CID 174866452) has the molecular formula C5H5Cl2MgN5O and a molecular weight of 246.34 g/mol. Its IUPAC name is magnesium;2-amino-1,7-dihydropurin-6-one;dichloride.
| Compound Name | magnesium;2-amino-1,7-dihydropurin-6-one;dichloride |
|---|---|
| PubChem CID | 174866452 |
| Molecular Formula | C5H5Cl2MgN5O |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | magnesium;2-amino-1,7-dihydropurin-6-one;dichloride |
| SMILES | Nc1nc2nc[nH]c2c(=O)[nH]1.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C5H5N5O.2ClH.Mg/c6-5-9-3-2(4(11)10-5)7-1-8-3;;;/h1H,(H4,6,7,8,9,10,11);2*1H;/q;;;+2/p-2 |
| InChIKey | QLFIBEYMNVMGFX-UHFFFAOYSA-L |
| XLogP | -7.14 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |