C7H9N5O3S — CID 157072098
2-amino-1,7-dihydropurin-6-one;2-sulfanylacetic acid (PubChem CID 157072098) has the molecular formula C7H9N5O3S and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;2-sulfanylacetic acid.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;2-sulfanylacetic acid |
|---|---|
| PubChem CID | 157072098 |
| Molecular Formula | C7H9N5O3S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;2-sulfanylacetic acid |
| SMILES | Nc1nc2nc[nH]c2c(=O)[nH]1.O=C(O)CS |
| InChI | InChI=1S/C5H5N5O.C2H4O2S/c6-5-9-3-2(4(11)10-5)7-1-8-3;3-2(4)1-5/h1H,(H4,6,7,8,9,10,11);5H,1H2,(H,3,4) |
| InChIKey | ACNYZHMTQHSCGT-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|