About 2-amino-1,7-dihydropurin-6-one;methoxymethane
2-amino-1,7-dihydropurin-6-one;methoxymethane (PubChem CID 170791174) has the molecular formula C7H11N5O2
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;methoxymethane.
Molecular Properties
| Compound Name | 2-amino-1,7-dihydropurin-6-one;methoxymethane |
| PubChem CID | 170791174 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;methoxymethane |
| SMILES | COC.Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5O.C2H6O/c6-5-9-3-2(4(11)10-5)7-1-8-3;1-3-2/h1H,(H4,6,7,8,9,10,11);1-2H3 |
| InChIKey | DFSVMASSCRRASB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1,7-dihydropurin-6-one;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,7-dihydropurin-6-one;methoxymethane?
The IUPAC name of 2-amino-1,7-dihydropurin-6-one;methoxymethane (CID 170791174) is 2-amino-1,7-dihydropurin-6-one;methoxymethane.
What is the SMILES notation for 2-amino-1,7-dihydropurin-6-one;methoxymethane?
The canonical SMILES for 2-amino-1,7-dihydropurin-6-one;methoxymethane is COC.Nc1nc2nc[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-amino-1,7-dihydropurin-6-one;methoxymethane?
The InChIKey is DFSVMASSCRRASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O.C2H6O/c6-5-9-3-2(4(11)10-5)7-1-8-3;1-3-2/h1H,(H4,6,7,8,9,10,11);1-2H3.
What are the key properties of 2-amino-1,7-dihydropurin-6-one;methoxymethane?
2-amino-1,7-dihydropurin-6-one;methoxymethane has a molecular weight of 197.20 g/mol, XLogP of -0.51, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,7-dihydropurin-6-one;methoxymethane is sourced from PubChem (CID 170791174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).