C19H13N5O3 — CID 136626730
2-amino-1,7-dihydropurin-6-one;anthracene-9,10-dione (PubChem CID 136626730) has the molecular formula C19H13N5O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;anthracene-9,10-dione.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;anthracene-9,10-dione |
|---|---|
| PubChem CID | 136626730 |
| Molecular Formula | C19H13N5O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;anthracene-9,10-dione |
| SMILES | Nc1nc2nc[nH]c2c(=O)[nH]1.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H8O2.C5H5N5O/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;6-5-9-3-2(4(11)10-5)7-1-8-3/h1-8H;1H,(H4,6,7,8,9,10,11) |
| InChIKey | XYKOEBHYKZBKOZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|