C9H11N8O5P — CID 175552966
2-amino-1,7-dihydropurin-6-one;(4-amino-2-oxopyrimidin-1-yl)phosphonic acid (PubChem CID 175552966) has the molecular formula C9H11N8O5P and a molecular weight of 342.21 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;(4-amino-2-oxopyrimidin-1-yl)phosphonic acid.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;(4-amino-2-oxopyrimidin-1-yl)phosphonic acid |
|---|---|
| PubChem CID | 175552966 |
| Molecular Formula | C9H11N8O5P |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;(4-amino-2-oxopyrimidin-1-yl)phosphonic acid |
| SMILES | Nc1ccn(P(=O)(O)O)c(=O)n1.Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5O.C4H6N3O4P/c6-5-9-3-2(4(11)10-5)7-1-8-3;5-3-1-2-7(4(8)6-3)12(9,10)11/h1H,(H4,6,7,8,9,10,11);1-2H,(H2,5,6,8)(H2,9,10,11) |
| InChIKey | XAAGIAHMTCFIPD-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 218.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|