C12H14N10O2 — CID 160674517
2-amino-1,7-dihydropurin-6-one;2-amino-7-ethyl-1H-purin-6-one (PubChem CID 160674517) has the molecular formula C12H14N10O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;2-amino-7-ethyl-1H-purin-6-one.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;2-amino-7-ethyl-1H-purin-6-one |
|---|---|
| PubChem CID | 160674517 |
| Molecular Formula | C12H14N10O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;2-amino-7-ethyl-1H-purin-6-one |
| SMILES | CCn1cnc2nc(N)[nH]c(=O)c21.Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H9N5O.C5H5N5O/c1-2-12-3-9-5-4(12)6(13)11-7(8)10-5;6-5-9-3-2(4(11)10-5)7-1-8-3/h3H,2H2,1H3,(H3,8,10,11,13);1H,(H4,6,7,8,9,10,11) |
| InChIKey | RNJCENDCDUPIQU-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 190.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |