C5H9CuN5O3 — CID 139263394
2-amino-1,7-dihydropurin-6-one;copper;dihydrate (PubChem CID 139263394) has the molecular formula C5H9CuN5O3 and a molecular weight of 250.71 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;copper;dihydrate.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;copper;dihydrate |
|---|---|
| PubChem CID | 139263394 |
| Molecular Formula | C5H9CuN5O3 |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;copper;dihydrate |
| SMILES | Nc1nc2nc[nH]c2c(=O)[nH]1.O.O.[Cu] |
| InChI | InChI=1S/C5H5N5O.Cu.2H2O/c6-5-9-3-2(4(11)10-5)7-1-8-3;;;/h1H,(H4,6,7,8,9,10,11);;2*1H2 |
| InChIKey | ZTWGYSZNZMLFJW-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |