C10H6Cl2N8O2 — CID 160598455
2-chloro-1,7-dihydropurin-6-one (PubChem CID 160598455) has the molecular formula C10H6Cl2N8O2 and a molecular weight of 341.12 g/mol. Its IUPAC name is 2-chloro-1,7-dihydropurin-6-one.
| Compound Name | 2-chloro-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 160598455 |
| Molecular Formula | C10H6Cl2N8O2 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-chloro-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(Cl)nc2nc[nH]c12.O=c1[nH]c(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/2C5H3ClN4O/c2*6-5-9-3-2(4(11)10-5)7-1-8-3/h2*1H,(H2,7,8,9,10,11) |
| InChIKey | RDYKXCAILBPEEA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 148.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |