C5H3N4NaOS — CID 135547004
sodium 6-oxo-1,7-dihydropurine-2-thiolate (PubChem CID 135547004) has the molecular formula C5H3N4NaOS and a molecular weight of 193.14 g/mol. Its IUPAC name is sodium 6-oxo-1,7-dihydropurine-2-thiolate.
| Compound Name | sodium 6-oxo-1,7-dihydropurine-2-thiolate |
|---|---|
| PubChem CID | 135547004 |
| Molecular Formula | C5H3N4NaOS |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 192.99 |
| IUPAC Name | sodium 6-oxo-1,7-dihydropurine-2-thiolate |
| SMILES | O=c1[15nH][13c]([S-])[15n]c2nc[nH]c12.[Na+] |
| InChI | InChI=1S/C5H4N4OS.Na/c10-4-2-3(7-1-6-2)8-5(11)9-4;/h1H,(H3,6,7,8,9,10,11);/q;+1/p-1/i5+1,8+1,9+1; |
| InChIKey | MYSULTPODUXIGN-GWFXBUFQSA-M |
| XLogP | -3.44 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|