C5H7N5O — CID 158320966
azane;1,7-dihydropurin-6-one (PubChem CID 158320966) has the molecular formula C5H7N5O and a molecular weight of 153.15 g/mol. Its IUPAC name is azane;1,7-dihydropurin-6-one.
| Compound Name | azane;1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 158320966 |
| Molecular Formula | C5H7N5O |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | azane;1,7-dihydropurin-6-one |
| SMILES | N.O=c1[nH]cnc2nc[nH]c12 |
| InChI | InChI=1S/C5H4N4O.H3N/c10-5-3-4(7-1-6-3)8-2-9-5;/h1-2H,(H2,6,7,8,9,10);1H3 |
| InChIKey | GOVOJJNGSSBEAT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |