About CID 135997841
CID 135997841 (PubChem CID 135997841) has the molecular formula C5H3AuN4OSe
and a molecular weight of 411.03 g/mol.
Molecular Properties
| Compound Name | CID 135997841 |
| PubChem CID | 135997841 |
| Molecular Formula | C5H3AuN4OSe |
| Molecular Weight | 411.03 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c([Se])nc2nc[nH]c12.[Au] |
| InChI | InChI=1S/C5H3N4OSe.Au/c10-4-2-3(7-1-6-2)8-5(11)9-4;/h1H,(H2,6,7,8,9,10); |
| InChIKey | ZFXDQDHDDBCAFN-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.03 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 135997841 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135997841?
The IUPAC name of CID 135997841 (CID 135997841) is not available.
What is the SMILES notation for CID 135997841?
The canonical SMILES for CID 135997841 is O=c1[nH]c([Se])nc2nc[nH]c12.[Au].
What is the InChIKey of CID 135997841?
The InChIKey is ZFXDQDHDDBCAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N4OSe.Au/c10-4-2-3(7-1-6-2)8-5(11)9-4;/h1H,(H2,6,7,8,9,10);.
What are the key properties of CID 135997841?
CID 135997841 has a molecular weight of 411.03 g/mol, XLogP of -1.56, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135997841 is sourced from PubChem (CID 135997841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).