C14H14N8O2 — CID 137190272
2-[4-(6-oxo-1,7-dihydropurin-2-yl)butyl]-1,7-dihydropurin-6-one (PubChem CID 137190272) has the molecular formula C14H14N8O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 2-[4-(6-oxo-1,7-dihydropurin-2-yl)butyl]-1,7-dihydropurin-6-one.
| Compound Name | 2-[4-(6-oxo-1,7-dihydropurin-2-yl)butyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 137190272 |
| Molecular Formula | C14H14N8O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[4-(6-oxo-1,7-dihydropurin-2-yl)butyl]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(CCCCc2nc3nc[nH]c3c(=O)[nH]2)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H14N8O2/c23-13-9-11(17-5-15-9)19-7(21-13)3-1-2-4-8-20-12-10(14(24)22-8)16-6-18-12/h5-6H,1-4H2,(H2,15,17,19,21,23)(H2,16,18,20,22,24) |
| InChIKey | KZHPNBCJOLRAPP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 148.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|