C7H8N4O2 — CID 150327797
2-(methoxymethyl)-1,7-dihydropurin-6-one (PubChem CID 150327797) has the molecular formula C7H8N4O2 and a molecular weight of 180.17 g/mol. Its IUPAC name is 2-(methoxymethyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-(methoxymethyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 150327797 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2-(methoxymethyl)-1,7-dihydropurin-6-one |
| SMILES | COCc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H8N4O2/c1-13-2-4-10-6-5(7(12)11-4)8-3-9-6/h3H,2H2,1H3,(H2,8,9,10,11,12) |
| InChIKey | GOZXCGMZRSXZGZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |