C9H13N5O3 — CID 136951529
2-(2,2-dimethoxyethylamino)-1,7-dihydropurin-6-one (PubChem CID 136951529) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylamino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(2,2-dimethoxyethylamino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136951529 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(2,2-dimethoxyethylamino)-1,7-dihydropurin-6-one |
| SMILES | COC(CNc1nc2nc[nH]c2c(=O)[nH]1)OC |
| InChI | InChI=1S/C9H13N5O3/c1-16-5(17-2)3-10-9-13-7-6(8(15)14-9)11-4-12-7/h4-5H,3H2,1-2H3,(H3,10,11,12,13,14,15) |
| InChIKey | BBQSDSMILGDTJL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|