C10H11N5OS — CID 174493595
2-(methylamino)-1,7-dihydropurin-6-one;thiophene (PubChem CID 174493595) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-(methylamino)-1,7-dihydropurin-6-one;thiophene.
| Compound Name | 2-(methylamino)-1,7-dihydropurin-6-one;thiophene |
|---|---|
| PubChem CID | 174493595 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(methylamino)-1,7-dihydropurin-6-one;thiophene |
| SMILES | CNc1nc2nc[nH]c2c(=O)[nH]1.c1ccsc1 |
| InChI | InChI=1S/C6H7N5O.C4H4S/c1-7-6-10-4-3(5(12)11-6)8-2-9-4;1-2-4-5-3-1/h2H,1H3,(H3,7,8,9,10,11,12);1-4H |
| InChIKey | XYESMNYZVJHRKA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |