About 2-(methylamino)-1,7-dihydropurin-6-one;thiophene
2-(methylamino)-1,7-dihydropurin-6-one;thiophene (PubChem CID 174493595) has the molecular formula C10H11N5OS
and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-(methylamino)-1,7-dihydropurin-6-one;thiophene.
Molecular Properties
| Compound Name | 2-(methylamino)-1,7-dihydropurin-6-one;thiophene |
| PubChem CID | 174493595 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(methylamino)-1,7-dihydropurin-6-one;thiophene |
| SMILES | CNc1nc2nc[nH]c2c(=O)[nH]1.c1ccsc1 |
| InChI | InChI=1S/C6H7N5O.C4H4S/c1-7-6-10-4-3(5(12)11-6)8-2-9-4;1-2-4-5-3-1/h2H,1H3,(H3,7,8,9,10,11,12);1-4H |
| InChIKey | XYESMNYZVJHRKA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(methylamino)-1,7-dihydropurin-6-one;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-1,7-dihydropurin-6-one;thiophene?
The IUPAC name of 2-(methylamino)-1,7-dihydropurin-6-one;thiophene (CID 174493595) is 2-(methylamino)-1,7-dihydropurin-6-one;thiophene.
What is the SMILES notation for 2-(methylamino)-1,7-dihydropurin-6-one;thiophene?
The canonical SMILES for 2-(methylamino)-1,7-dihydropurin-6-one;thiophene is CNc1nc2nc[nH]c2c(=O)[nH]1.c1ccsc1.
What is the InChIKey of 2-(methylamino)-1,7-dihydropurin-6-one;thiophene?
The InChIKey is XYESMNYZVJHRKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O.C4H4S/c1-7-6-10-4-3(5(12)11-6)8-2-9-4;1-2-4-5-3-1/h2H,1H3,(H3,7,8,9,10,11,12);1-4H.
What are the key properties of 2-(methylamino)-1,7-dihydropurin-6-one;thiophene?
2-(methylamino)-1,7-dihydropurin-6-one;thiophene has a molecular weight of 249.30 g/mol, XLogP of 1.44, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-1,7-dihydropurin-6-one;thiophene is sourced from PubChem (CID 174493595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).