C15H11N5O — CID 135435088
2-(naphthalen-2-ylamino)-1,7-dihydropurin-6-one (PubChem CID 135435088) has the molecular formula C15H11N5O and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-(naphthalen-2-ylamino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(naphthalen-2-ylamino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135435088 |
| Molecular Formula | C15H11N5O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-(naphthalen-2-ylamino)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(Nc2ccc3ccccc3c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C15H11N5O/c21-14-12-13(17-8-16-12)19-15(20-14)18-11-6-5-9-3-1-2-4-10(9)7-11/h1-8H,(H3,16,17,18,19,20,21) |
| InChIKey | YUGNFZWBAPYCBO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |