C15H12N6O — CID 169449405
2-[(2-aminonaphthalen-1-yl)amino]-1,7-dihydropurin-6-one (PubChem CID 169449405) has the molecular formula C15H12N6O and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[(2-aminonaphthalen-1-yl)amino]-1,7-dihydropurin-6-one.
| Compound Name | 2-[(2-aminonaphthalen-1-yl)amino]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 169449405 |
| Molecular Formula | C15H12N6O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[(2-aminonaphthalen-1-yl)amino]-1,7-dihydropurin-6-one |
| SMILES | Nc1ccc2ccccc2c1Nc1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C15H12N6O/c16-10-6-5-8-3-1-2-4-9(8)11(10)19-15-20-13-12(14(22)21-15)17-7-18-13/h1-7H,16H2,(H3,17,18,19,20,21,22) |
| InChIKey | IJOPAHJQUICXLP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|