C13H13N5O — CID 135435049
2-(3-ethylanilino)-1,7-dihydropurin-6-one (PubChem CID 135435049) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(3-ethylanilino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(3-ethylanilino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135435049 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-(3-ethylanilino)-1,7-dihydropurin-6-one |
| SMILES | CCc1cccc(Nc2nc3nc[nH]c3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C13H13N5O/c1-2-8-4-3-5-9(6-8)16-13-17-11-10(12(19)18-13)14-7-15-11/h3-7H,2H2,1H3,(H3,14,15,16,17,18,19) |
| InChIKey | RPKIAWXFDCYUPC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |