C14H10N6O — CID 135998458
2-(quinolin-6-ylamino)-1,7-dihydropurin-6-one (PubChem CID 135998458) has the molecular formula C14H10N6O and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-(quinolin-6-ylamino)-1,7-dihydropurin-6-one.
| Compound Name | 2-(quinolin-6-ylamino)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135998458 |
| Molecular Formula | C14H10N6O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(quinolin-6-ylamino)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(Nc2ccc3ncccc3c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H10N6O/c21-13-11-12(17-7-16-11)19-14(20-13)18-9-3-4-10-8(6-9)2-1-5-15-10/h1-7H,(H3,16,17,18,19,20,21) |
| InChIKey | SXIFQBFHHIMSOW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |