C14H11N7 — CID 117084904
2-N-quinolin-6-yl-7H-purine-2,6-diamine (PubChem CID 117084904) has the molecular formula C14H11N7 and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-N-quinolin-6-yl-7H-purine-2,6-diamine.
| Compound Name | 2-N-quinolin-6-yl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 117084904 |
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-N-quinolin-6-yl-7H-purine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc3ncccc3c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H11N7/c15-12-11-13(18-7-17-11)21-14(20-12)19-9-3-4-10-8(6-9)2-1-5-16-10/h1-7H,(H4,15,17,18,19,20,21) |
| InChIKey | YSZDJRFPKLEUMU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |