C20H15N7 — CID 117093201
9-phenyl-2-N-quinolin-6-ylpurine-2,6-diamine (PubChem CID 117093201) has the molecular formula C20H15N7 and a molecular weight of 353.39 g/mol. Its IUPAC name is 9-phenyl-2-N-quinolin-6-ylpurine-2,6-diamine.
| Compound Name | 9-phenyl-2-N-quinolin-6-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117093201 |
| Molecular Formula | C20H15N7 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 9-phenyl-2-N-quinolin-6-ylpurine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc3ncccc3c2)nc2c1ncn2-c1ccccc1 |
| InChI | InChI=1S/C20H15N7/c21-18-17-19(27(12-23-17)15-6-2-1-3-7-15)26-20(25-18)24-14-8-9-16-13(11-14)5-4-10-22-16/h1-12H,(H3,21,24,25,26) |
| InChIKey | SRVNUINYAAKHJR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |