C18H16N8 — CID 117078892
6-N-cyclopropyl-9-phenyl-2-N-pyrimidin-2-ylpurine-2,6-diamine (PubChem CID 117078892) has the molecular formula C18H16N8 and a molecular weight of 344.38 g/mol. Its IUPAC name is 6-N-cyclopropyl-9-phenyl-2-N-pyrimidin-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-cyclopropyl-9-phenyl-2-N-pyrimidin-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117078892 |
| Molecular Formula | C18H16N8 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 6-N-cyclopropyl-9-phenyl-2-N-pyrimidin-2-ylpurine-2,6-diamine |
| SMILES | c1ccc(-n2cnc3c(NC4CC4)nc(Nc4ncccn4)nc32)cc1 |
| InChI | InChI=1S/C18H16N8/c1-2-5-13(6-3-1)26-11-21-14-15(22-12-7-8-12)23-18(24-16(14)26)25-17-19-9-4-10-20-17/h1-6,9-12H,7-8H2,(H2,19,20,22,23,24,25) |
| InChIKey | RGPFBGNFHWXWHI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |