C26H31N7 — CID 117079494
2-N-(1-benzylpiperidin-4-yl)-9-phenyl-6-N-propylpurine-2,6-diamine (PubChem CID 117079494) has the molecular formula C26H31N7 and a molecular weight of 441.58 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-4-yl)-9-phenyl-6-N-propylpurine-2,6-diamine.
| Compound Name | 2-N-(1-benzylpiperidin-4-yl)-9-phenyl-6-N-propylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117079494 |
| Molecular Formula | C26H31N7 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 2-N-(1-benzylpiperidin-4-yl)-9-phenyl-6-N-propylpurine-2,6-diamine |
| SMILES | CCCNc1nc(NC2CCN(Cc3ccccc3)CC2)nc2c1ncn2-c1ccccc1 |
| InChI | InChI=1S/C26H31N7/c1-2-15-27-24-23-25(33(19-28-23)22-11-7-4-8-12-22)31-26(30-24)29-21-13-16-32(17-14-21)18-20-9-5-3-6-10-20/h3-12,19,21H,2,13-18H2,1H3,(H2,27,29,30,31) |
| InChIKey | HBMBBZVBEVWSJG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |