C24H29N7S — CID 117079496
2-N-(1-benzylpiperidin-4-yl)-6-N-propyl-9-thiophen-3-ylpurine-2,6-diamine (PubChem CID 117079496) has the molecular formula C24H29N7S and a molecular weight of 447.61 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-4-yl)-6-N-propyl-9-thiophen-3-ylpurine-2,6-diamine.
| Compound Name | 2-N-(1-benzylpiperidin-4-yl)-6-N-propyl-9-thiophen-3-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117079496 |
| Molecular Formula | C24H29N7S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-N-(1-benzylpiperidin-4-yl)-6-N-propyl-9-thiophen-3-ylpurine-2,6-diamine |
| SMILES | CCCNc1nc(NC2CCN(Cc3ccccc3)CC2)nc2c1ncn2-c1ccsc1 |
| InChI | InChI=1S/C24H29N7S/c1-2-11-25-22-21-23(31(17-26-21)20-10-14-32-16-20)29-24(28-22)27-19-8-12-30(13-9-19)15-18-6-4-3-5-7-18/h3-7,10,14,16-17,19H,2,8-9,11-13,15H2,1H3,(H2,25,27,28,29) |
| InChIKey | MHQRYHQBFGOKOJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |