C26H21N7OS — CID 117086995
4-[2-[[2-(isoquinolin-1-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol (PubChem CID 117086995) has the molecular formula C26H21N7OS and a molecular weight of 479.57 g/mol. Its IUPAC name is 4-[2-[[2-(isoquinolin-1-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(isoquinolin-1-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117086995 |
| Molecular Formula | C26H21N7OS |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 4-[2-[[2-(isoquinolin-1-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2nc(Nc3nccc4ccccc34)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C26H21N7OS/c34-20-7-5-17(6-8-20)9-12-28-24-22-25(33(16-29-22)19-11-14-35-15-19)32-26(31-24)30-23-21-4-2-1-3-18(21)10-13-27-23/h1-8,10-11,13-16,34H,9,12H2,(H2,27,28,30,31,32) |
| InChIKey | KQCKHFUDGIKZOF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |