C20H22N8O — CID 117082206
4-[2-[[9-propan-2-yl-2-(pyrazin-2-ylamino)purin-6-yl]amino]ethyl]phenol (PubChem CID 117082206) has the molecular formula C20H22N8O and a molecular weight of 390.45 g/mol. Its IUPAC name is 4-[2-[[9-propan-2-yl-2-(pyrazin-2-ylamino)purin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[9-propan-2-yl-2-(pyrazin-2-ylamino)purin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117082206 |
| Molecular Formula | C20H22N8O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[2-[[9-propan-2-yl-2-(pyrazin-2-ylamino)purin-6-yl]amino]ethyl]phenol |
| SMILES | CC(C)n1cnc2c(NCCc3ccc(O)cc3)nc(Nc3cnccn3)nc21 |
| InChI | InChI=1S/C20H22N8O/c1-13(2)28-12-24-17-18(23-8-7-14-3-5-15(29)6-4-14)26-20(27-19(17)28)25-16-11-21-9-10-22-16/h3-6,9-13,29H,7-8H2,1-2H3,(H2,22,23,25,26,27) |
| InChIKey | AHRDJVWQDQIREF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |