C22H24N6O — CID 117083902
6-N-(2-phenoxyethyl)-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine (PubChem CID 117083902) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 6-N-(2-phenoxyethyl)-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-(2-phenoxyethyl)-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117083902 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 6-N-(2-phenoxyethyl)-2-N-phenyl-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(NCCOc3ccccc3)nc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C22H24N6O/c1-16(2)28-15-24-19-20(23-13-14-29-18-11-7-4-8-12-18)26-22(27-21(19)28)25-17-9-5-3-6-10-17/h3-12,15-16H,13-14H2,1-2H3,(H2,23,25,26,27) |
| InChIKey | GBORUHGDKGRXGV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|