C26H21F3N6O — CID 117088420
6-N-(2-phenoxyethyl)-9-phenyl-2-N-[4-(trifluoromethyl)phenyl]purine-2,6-diamine (PubChem CID 117088420) has the molecular formula C26H21F3N6O and a molecular weight of 490.49 g/mol. Its IUPAC name is 6-N-(2-phenoxyethyl)-9-phenyl-2-N-[4-(trifluoromethyl)phenyl]purine-2,6-diamine.
| Compound Name | 6-N-(2-phenoxyethyl)-9-phenyl-2-N-[4-(trifluoromethyl)phenyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 117088420 |
| Molecular Formula | C26H21F3N6O |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 6-N-(2-phenoxyethyl)-9-phenyl-2-N-[4-(trifluoromethyl)phenyl]purine-2,6-diamine |
| SMILES | FC(F)(F)c1ccc(Nc2nc(NCCOc3ccccc3)c3ncn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C26H21F3N6O/c27-26(28,29)18-11-13-19(14-12-18)32-25-33-23(30-15-16-36-21-9-5-2-6-10-21)22-24(34-25)35(17-31-22)20-7-3-1-4-8-20/h1-14,17H,15-16H2,(H2,30,32,33,34) |
| InChIKey | RHSRNFBYQKYBFD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|