C27H23F3N6O — CID 117086459
6-N-(2-phenoxyethyl)-2-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine (PubChem CID 117086459) has the molecular formula C27H23F3N6O and a molecular weight of 504.52 g/mol. Its IUPAC name is 6-N-(2-phenoxyethyl)-2-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine.
| Compound Name | 6-N-(2-phenoxyethyl)-2-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 117086459 |
| Molecular Formula | C27H23F3N6O |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 6-N-(2-phenoxyethyl)-2-N-phenyl-9-[[4-(trifluoromethyl)phenyl]methyl]purine-2,6-diamine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(NCCOc4ccccc4)nc(Nc4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C27H23F3N6O/c28-27(29,30)20-13-11-19(12-14-20)17-36-18-32-23-24(31-15-16-37-22-9-5-2-6-10-22)34-26(35-25(23)36)33-21-7-3-1-4-8-21/h1-14,18H,15-17H2,(H2,31,33,34,35) |
| InChIKey | OTMASAWVJWKMOQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|