C30H28F3N7O2 — CID 117082690
2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117082690) has the molecular formula C30H28F3N7O2 and a molecular weight of 575.60 g/mol. Its IUPAC name is 2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117082690 |
| Molecular Formula | C30H28F3N7O2 |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 2-(6-morpholin-4-yl-3-pyridinyl)-N-(2-phenoxyethyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(NCCOc4ccccc4)nc(-c4ccc(N5CCOCC5)nc4)nc32)cc1 |
| InChI | InChI=1S/C30H28F3N7O2/c31-30(32,33)23-9-6-21(7-10-23)19-40-20-36-26-28(34-12-15-42-24-4-2-1-3-5-24)37-27(38-29(26)40)22-8-11-25(35-18-22)39-13-16-41-17-14-39/h1-11,18,20H,12-17,19H2,(H,34,37,38) |
| InChIKey | BMNDMTKKWAMYDN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|