C22H23N7O2 — CID 117081487
2-[[2-(6-morpholin-4-yl-3-pyridinyl)-9-phenylpurin-6-yl]amino]ethanol (PubChem CID 117081487) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[[2-(6-morpholin-4-yl-3-pyridinyl)-9-phenylpurin-6-yl]amino]ethanol.
| Compound Name | 2-[[2-(6-morpholin-4-yl-3-pyridinyl)-9-phenylpurin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 117081487 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-[[2-(6-morpholin-4-yl-3-pyridinyl)-9-phenylpurin-6-yl]amino]ethanol |
| SMILES | OCCNc1nc(-c2ccc(N3CCOCC3)nc2)nc2c1ncn2-c1ccccc1 |
| InChI | InChI=1S/C22H23N7O2/c30-11-8-23-21-19-22(29(15-25-19)17-4-2-1-3-5-17)27-20(26-21)16-6-7-18(24-14-16)28-9-12-31-13-10-28/h1-7,14-15,30H,8-13H2,(H,23,26,27) |
| InChIKey | WTCPLPQDXJFIBL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |