C23H29N7O — CID 117089738
9-cyclohexyl-N-cyclopropyl-2-(6-morpholin-4-yl-3-pyridinyl)purin-6-amine (PubChem CID 117089738) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 9-cyclohexyl-N-cyclopropyl-2-(6-morpholin-4-yl-3-pyridinyl)purin-6-amine.
| Compound Name | 9-cyclohexyl-N-cyclopropyl-2-(6-morpholin-4-yl-3-pyridinyl)purin-6-amine |
|---|---|
| PubChem CID | 117089738 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 9-cyclohexyl-N-cyclopropyl-2-(6-morpholin-4-yl-3-pyridinyl)purin-6-amine |
| SMILES | c1cc(N2CCOCC2)ncc1-c1nc(NC2CC2)c2ncn(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C23H29N7O/c1-2-4-18(5-3-1)30-15-25-20-22(26-17-7-8-17)27-21(28-23(20)30)16-6-9-19(24-14-16)29-10-12-31-13-11-29/h6,9,14-15,17-18H,1-5,7-8,10-13H2,(H,26,27,28) |
| InChIKey | YMKCVFURBOAJQB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |