C30H36N6O — CID 117088891
N-(1-benzylpiperidin-4-yl)-9-cyclohexyl-2-(4-methoxyphenyl)purin-6-amine (PubChem CID 117088891) has the molecular formula C30H36N6O and a molecular weight of 496.66 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-9-cyclohexyl-2-(4-methoxyphenyl)purin-6-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-9-cyclohexyl-2-(4-methoxyphenyl)purin-6-amine |
|---|---|
| PubChem CID | 117088891 |
| Molecular Formula | C30H36N6O |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-9-cyclohexyl-2-(4-methoxyphenyl)purin-6-amine |
| SMILES | COc1ccc(-c2nc(NC3CCN(Cc4ccccc4)CC3)c3ncn(C4CCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C30H36N6O/c1-37-26-14-12-23(13-15-26)28-33-29(27-30(34-28)36(21-31-27)25-10-6-3-7-11-25)32-24-16-18-35(19-17-24)20-22-8-4-2-5-9-22/h2,4-5,8-9,12-15,21,24-25H,3,6-7,10-11,16-20H2,1H3,(H,32,33,34) |
| InChIKey | CMLQMTBAHASHBD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |