C29H28N6O2 — CID 117093779
9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(4-phenoxyphenyl)purin-6-amine (PubChem CID 117093779) has the molecular formula C29H28N6O2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(4-phenoxyphenyl)purin-6-amine.
| Compound Name | 9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(4-phenoxyphenyl)purin-6-amine |
|---|---|
| PubChem CID | 117093779 |
| Molecular Formula | C29H28N6O2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(4-phenoxyphenyl)purin-6-amine |
| SMILES | COc1ccc(-c2nc(Nc3ccc(Oc4ccccc4)cc3)c3ncn(C4CCCCC4)c3n2)cn1 |
| InChI | InChI=1S/C29H28N6O2/c1-36-25-17-12-20(18-30-25)27-33-28(26-29(34-27)35(19-31-26)22-8-4-2-5-9-22)32-21-13-15-24(16-14-21)37-23-10-6-3-7-11-23/h3,6-7,10-19,22H,2,4-5,8-9H2,1H3,(H,32,33,34) |
| InChIKey | BQDGZCGSGRLWMC-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |