C22H22N6 — CID 57147797
9-cyclopentyl-6-N-(4-phenylphenyl)purine-2,6-diamine (PubChem CID 57147797) has the molecular formula C22H22N6 and a molecular weight of 370.46 g/mol. Its IUPAC name is 9-cyclopentyl-6-N-(4-phenylphenyl)purine-2,6-diamine.
| Compound Name | 9-cyclopentyl-6-N-(4-phenylphenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 57147797 |
| Molecular Formula | C22H22N6 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 9-cyclopentyl-6-N-(4-phenylphenyl)purine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc(-c3ccccc3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C22H22N6/c23-22-26-20(19-21(27-22)28(14-24-19)18-8-4-5-9-18)25-17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-3,6-7,10-14,18H,4-5,8-9H2,(H3,23,25,26,27) |
| InChIKey | IGQMZNFHTWSTKM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |