C19H21ClN6O — CID 117089119
N-[4-[(2-chloro-9-cyclohexylpurin-6-yl)amino]phenyl]acetamide (PubChem CID 117089119) has the molecular formula C19H21ClN6O and a molecular weight of 384.87 g/mol. Its IUPAC name is N-[4-[(2-chloro-9-cyclohexylpurin-6-yl)amino]phenyl]acetamide.
| Compound Name | N-[4-[(2-chloro-9-cyclohexylpurin-6-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117089119 |
| Molecular Formula | C19H21ClN6O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[4-[(2-chloro-9-cyclohexylpurin-6-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(Cl)nc3c2ncn3C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H21ClN6O/c1-12(27)22-13-7-9-14(10-8-13)23-17-16-18(25-19(20)24-17)26(11-21-16)15-5-3-2-4-6-15/h7-11,15H,2-6H2,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | YJHYKJMZAKVTJE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |