C29H34N8O2 — CID 117086882
N-[4-[[9-cyclohexyl-2-(4-morpholin-4-ylanilino)purin-6-yl]amino]phenyl]acetamide (PubChem CID 117086882) has the molecular formula C29H34N8O2 and a molecular weight of 526.65 g/mol. Its IUPAC name is N-[4-[[9-cyclohexyl-2-(4-morpholin-4-ylanilino)purin-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[9-cyclohexyl-2-(4-morpholin-4-ylanilino)purin-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117086882 |
| Molecular Formula | C29H34N8O2 |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N-[4-[[9-cyclohexyl-2-(4-morpholin-4-ylanilino)purin-6-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(Nc3ccc(N4CCOCC4)cc3)nc3c2ncn3C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H34N8O2/c1-20(38)31-21-7-9-22(10-8-21)32-27-26-28(37(19-30-26)25-5-3-2-4-6-25)35-29(34-27)33-23-11-13-24(14-12-23)36-15-17-39-18-16-36/h7-14,19,25H,2-6,15-18H2,1H3,(H,31,38)(H2,32,33,34,35) |
| InChIKey | RKJMZATUFZGBNH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|