C27H38N8O2 — CID 117092719
9-cyclohexyl-2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine (PubChem CID 117092719) has the molecular formula C27H38N8O2 and a molecular weight of 506.66 g/mol. Its IUPAC name is 9-cyclohexyl-2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine.
| Compound Name | 9-cyclohexyl-2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117092719 |
| Molecular Formula | C27H38N8O2 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 9-cyclohexyl-2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine |
| SMILES | c1cc(N2CCOCC2)ccc1Nc1nc(NCCN2CCOCC2)nc2c1ncn2C1CCCCC1 |
| InChI | InChI=1S/C27H38N8O2/c1-2-4-23(5-3-1)35-20-29-24-25(30-21-6-8-22(9-7-21)34-14-18-37-19-15-34)31-27(32-26(24)35)28-10-11-33-12-16-36-17-13-33/h6-9,20,23H,1-5,10-19H2,(H2,28,30,31,32) |
| InChIKey | NIUBFQNGPKMNIB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|