C24H32N8O2 — CID 151387867
[4-[[2-(3-aminopropylamino)-9-cyclopentylpurin-6-yl]amino]phenyl]-morpholin-4-ylmethanone (PubChem CID 151387867) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is [4-[[2-(3-aminopropylamino)-9-cyclopentylpurin-6-yl]amino]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[[2-(3-aminopropylamino)-9-cyclopentylpurin-6-yl]amino]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 151387867 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [4-[[2-(3-aminopropylamino)-9-cyclopentylpurin-6-yl]amino]phenyl]-morpholin-4-ylmethanone |
| SMILES | NCCCNc1nc(Nc2ccc(C(=O)N3CCOCC3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C24H32N8O2/c25-10-3-11-26-24-29-21(20-22(30-24)32(16-27-20)19-4-1-2-5-19)28-18-8-6-17(7-9-18)23(33)31-12-14-34-15-13-31/h6-9,16,19H,1-5,10-15,25H2,(H2,26,28,29,30) |
| InChIKey | OTULZPWZOXZADX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|