C27H30N6O — CID 117085834
9-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylpurin-6-amine (PubChem CID 117085834) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 9-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylpurin-6-amine.
| Compound Name | 9-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylpurin-6-amine |
|---|---|
| PubChem CID | 117085834 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 9-cyclohexyl-N-(4-morpholin-4-ylphenyl)-2-phenylpurin-6-amine |
| SMILES | c1ccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)c3ncn(C4CCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C27H30N6O/c1-3-7-20(8-4-1)25-30-26(24-27(31-25)33(19-28-24)23-9-5-2-6-10-23)29-21-11-13-22(14-12-21)32-15-17-34-18-16-32/h1,3-4,7-8,11-14,19,23H,2,5-6,9-10,15-18H2,(H,29,30,31) |
| InChIKey | RQEIOLRXTLOPKD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|