C27H24N6O — CID 117081365
N-(4-morpholin-4-ylphenyl)-2,9-diphenylpurin-6-amine (PubChem CID 117081365) has the molecular formula C27H24N6O and a molecular weight of 448.53 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2,9-diphenylpurin-6-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2,9-diphenylpurin-6-amine |
|---|---|
| PubChem CID | 117081365 |
| Molecular Formula | C27H24N6O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2,9-diphenylpurin-6-amine |
| SMILES | c1ccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)c3ncn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C27H24N6O/c1-3-7-20(8-4-1)25-30-26(24-27(31-25)33(19-28-24)23-9-5-2-6-10-23)29-21-11-13-22(14-12-21)32-15-17-34-18-16-32/h1-14,19H,15-18H2,(H,29,30,31) |
| InChIKey | MTTJFNNUWAFIKW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|