C29H29N7O2 — CID 117089790
2-N-(4-morpholin-4-ylphenyl)-6-N-(2-phenoxyethyl)-9-phenylpurine-2,6-diamine (PubChem CID 117089790) has the molecular formula C29H29N7O2 and a molecular weight of 507.60 g/mol. Its IUPAC name is 2-N-(4-morpholin-4-ylphenyl)-6-N-(2-phenoxyethyl)-9-phenylpurine-2,6-diamine.
| Compound Name | 2-N-(4-morpholin-4-ylphenyl)-6-N-(2-phenoxyethyl)-9-phenylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117089790 |
| Molecular Formula | C29H29N7O2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 2-N-(4-morpholin-4-ylphenyl)-6-N-(2-phenoxyethyl)-9-phenylpurine-2,6-diamine |
| SMILES | c1ccc(OCCNc2nc(Nc3ccc(N4CCOCC4)cc3)nc3c2ncn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H29N7O2/c1-3-7-24(8-4-1)36-21-31-26-27(30-15-18-38-25-9-5-2-6-10-25)33-29(34-28(26)36)32-22-11-13-23(14-12-22)35-16-19-37-20-17-35/h1-14,21H,15-20H2,(H2,30,32,33,34) |
| InChIKey | BGTFYRGPWXSVGH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|