C28H29N7O2S — CID 117087145
6-N-[2-(4-methoxyphenyl)ethyl]-2-N-(4-morpholin-4-ylphenyl)-9-thiophen-3-ylpurine-2,6-diamine (PubChem CID 117087145) has the molecular formula C28H29N7O2S and a molecular weight of 527.65 g/mol. Its IUPAC name is 6-N-[2-(4-methoxyphenyl)ethyl]-2-N-(4-morpholin-4-ylphenyl)-9-thiophen-3-ylpurine-2,6-diamine.
| Compound Name | 6-N-[2-(4-methoxyphenyl)ethyl]-2-N-(4-morpholin-4-ylphenyl)-9-thiophen-3-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117087145 |
| Molecular Formula | C28H29N7O2S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 6-N-[2-(4-methoxyphenyl)ethyl]-2-N-(4-morpholin-4-ylphenyl)-9-thiophen-3-ylpurine-2,6-diamine |
| SMILES | COc1ccc(CCNc2nc(Nc3ccc(N4CCOCC4)cc3)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C28H29N7O2S/c1-36-24-8-2-20(3-9-24)10-12-29-26-25-27(35(19-30-25)23-11-17-38-18-23)33-28(32-26)31-21-4-6-22(7-5-21)34-13-15-37-16-14-34/h2-9,11,17-19H,10,12-16H2,1H3,(H2,29,31,32,33) |
| InChIKey | XAEXWJDDTCDVHU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|